C25H21ClN4OS — CID 6891711
N-[(E)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 6891711) has the molecular formula C25H21ClN4OS and a molecular weight of 460.99 g/mol. Its IUPAC name is N-[(E)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6891711 |
| Molecular Formula | C25H21ClN4OS |
| Molecular Weight | 460.99 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | N-[(E)-[1-[3-(2-chlorophenoxy)propyl]indol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccccc1OCCCn1cc(/C=N/Nc2nc3ccccc3s2)c2ccccc21 |
| InChI | InChI=1S/C25H21ClN4OS/c26-20-9-2-5-12-23(20)31-15-7-14-30-17-18(19-8-1-4-11-22(19)30)16-27-29-25-28-21-10-3-6-13-24(21)32-25/h1-6,8-13,16-17H,7,14-15H2,(H,28,29)/b27-16+ |
| InChIKey | JDIMBFLXYRQEIH-JVWAILMASA-N |
| XLogP | 6.82 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.99 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|