C20H17ClN4OS — CID 1395405
N-[[1-[2-(4-chlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 1395405) has the molecular formula C20H17ClN4OS and a molecular weight of 396.90 g/mol. Its IUPAC name is N-[[1-[2-(4-chlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[[1-[2-(4-chlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 1395405 |
| Molecular Formula | C20H17ClN4OS |
| Molecular Weight | 396.90 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | N-[[1-[2-(4-chlorophenoxy)ethyl]pyrrol-2-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Clc1ccc(OCCn2cccc2C=NNc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C20H17ClN4OS/c21-15-7-9-17(10-8-15)26-13-12-25-11-3-4-16(25)14-22-24-20-23-18-5-1-2-6-19(18)27-20/h1-11,14H,12-13H2,(H,23,24) |
| InChIKey | CKSSJZRNDDLXJN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 51.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_pyrrol(64)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|