C20H17NO6S — CID 68919763
6-[benzyl(methyl)carbamoyl]-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid (PubChem CID 68919763) has the molecular formula C20H17NO6S and a molecular weight of 399.42 g/mol. Its IUPAC name is 6-[benzyl(methyl)carbamoyl]-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid.
| Compound Name | 6-[benzyl(methyl)carbamoyl]-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 68919763 |
| Molecular Formula | C20H17NO6S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | 6-[benzyl(methyl)carbamoyl]-3-(carboxymethoxy)-1-benzothiophene-2-carboxylic acid |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccc2c(OCC(=O)O)c(C(=O)O)sc2c1 |
| InChI | InChI=1S/C20H17NO6S/c1-21(10-12-5-3-2-4-6-12)19(24)13-7-8-14-15(9-13)28-18(20(25)26)17(14)27-11-16(22)23/h2-9H,10-11H2,1H3,(H,22,23)(H,25,26) |
| InChIKey | USJVBEQLBAMVBO-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |