C19H27ClN3O2+ — CID 68922108
(3S)-1-tert-butyl-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidin-1-ium-1-carboxylic acid (PubChem CID 68922108) has the molecular formula C19H27ClN3O2+ and a molecular weight of 364.90 g/mol. Its IUPAC name is (3S)-1-tert-butyl-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidin-1-ium-1-carboxylic acid.
| Compound Name | (3S)-1-tert-butyl-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidin-1-ium-1-carboxylic acid |
|---|---|
| PubChem CID | 68922108 |
| Molecular Formula | C19H27ClN3O2+ |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (3S)-1-tert-butyl-3-[[2-(chloromethyl)benzimidazol-1-yl]methyl]piperidin-1-ium-1-carboxylic acid |
| SMILES | CC(C)(C)[N+]1(C(=O)O)CCC[C@@H](Cn2c(CCl)nc3ccccc32)C1 |
| InChI | InChI=1S/C19H26ClN3O2/c1-19(2,3)23(18(24)25)10-6-7-14(13-23)12-22-16-9-5-4-8-15(16)21-17(22)11-20/h4-5,8-9,14H,6-7,10-13H2,1-3H3/p+1/t14-,23?/m0/s1 |
| InChIKey | XGGCIJNKRDHGKW-JRQMZCAUSA-O |
| XLogP | 4.48 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|