C21H19Cl3N2O3S — CID 68924772
2-[1,2,8-trichloro-6-(2,3-dimethoxyphenyl)-4,6-dihydroimidazo[1,2-a][4,1]benzothiazepin-4-yl]ethanol (PubChem CID 68924772) has the molecular formula C21H19Cl3N2O3S and a molecular weight of 485.82 g/mol. Its IUPAC name is 2-[1,2,8-trichloro-6-(2,3-dimethoxyphenyl)-4,6-dihydroimidazo[1,2-a][4,1]benzothiazepin-4-yl]ethanol.
| Compound Name | 2-[1,2,8-trichloro-6-(2,3-dimethoxyphenyl)-4,6-dihydroimidazo[1,2-a][4,1]benzothiazepin-4-yl]ethanol |
|---|---|
| PubChem CID | 68924772 |
| Molecular Formula | C21H19Cl3N2O3S |
| Molecular Weight | 485.82 g/mol |
| Exact Mass | 484.02 |
| IUPAC Name | 2-[1,2,8-trichloro-6-(2,3-dimethoxyphenyl)-4,6-dihydroimidazo[1,2-a][4,1]benzothiazepin-4-yl]ethanol |
| SMILES | COc1cccc(C2SC(CCO)c3nc(Cl)c(Cl)n3-c3ccc(Cl)cc32)c1OC |
| InChI | InChI=1S/C21H19Cl3N2O3S/c1-28-15-5-3-4-12(17(15)29-2)18-13-10-11(22)6-7-14(13)26-20(24)19(23)25-21(26)16(30-18)8-9-27/h3-7,10,16,18,27H,8-9H2,1-2H3 |
| InChIKey | SMPKTPWGLOGKEN-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.82 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |