C23H20ClN3O2S — CID 68927266
4-[2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]benzene-1,2-diol (PubChem CID 68927266) has the molecular formula C23H20ClN3O2S and a molecular weight of 437.95 g/mol. Its IUPAC name is 4-[2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]benzene-1,2-diol.
| Compound Name | 4-[2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 68927266 |
| Molecular Formula | C23H20ClN3O2S |
| Molecular Weight | 437.95 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | 4-[2-[[4-(4-chlorophenyl)-5-(4-methylphenyl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]benzene-1,2-diol |
| SMILES | Cc1ccc(-c2nnc(SCCc3ccc(O)c(O)c3)n2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H20ClN3O2S/c1-15-2-5-17(6-3-15)22-25-26-23(27(22)19-9-7-18(24)8-10-19)30-13-12-16-4-11-20(28)21(29)14-16/h2-11,14,28-29H,12-13H2,1H3 |
| InChIKey | FQGJIBXMJUZIBJ-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.95 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|