C19H22F3NO3S — CID 68932963
2-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-3-methylbutane-1-sulfonamide (PubChem CID 68932963) has the molecular formula C19H22F3NO3S and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-3-methylbutane-1-sulfonamide.
| Compound Name | 2-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 68932963 |
| Molecular Formula | C19H22F3NO3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-3-methylbutane-1-sulfonamide |
| SMILES | COc1ccccc1-c1ccc(C(F)(F)F)cc1C(CS(N)(=O)=O)C(C)C |
| InChI | InChI=1S/C19H22F3NO3S/c1-12(2)17(11-27(23,24)25)16-10-13(19(20,21)22)8-9-14(16)15-6-4-5-7-18(15)26-3/h4-10,12,17H,11H2,1-3H3,(H2,23,24,25) |
| InChIKey | LIXBXGPPVPBQHH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |