C21H26F3NO — CID 68629743
4-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-5-methylhexan-3-amine (PubChem CID 68629743) has the molecular formula C21H26F3NO and a molecular weight of 365.44 g/mol. Its IUPAC name is 4-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-5-methylhexan-3-amine.
| Compound Name | 4-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-5-methylhexan-3-amine |
|---|---|
| PubChem CID | 68629743 |
| Molecular Formula | C21H26F3NO |
| Molecular Weight | 365.44 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 4-[2-(2-methoxyphenyl)-5-(trifluoromethyl)phenyl]-5-methylhexan-3-amine |
| SMILES | CCC(N)C(c1cc(C(F)(F)F)ccc1-c1ccccc1OC)C(C)C |
| InChI | InChI=1S/C21H26F3NO/c1-5-18(25)20(13(2)3)17-12-14(21(22,23)24)10-11-15(17)16-8-6-7-9-19(16)26-4/h6-13,18,20H,5,25H2,1-4H3 |
| InChIKey | LMSSSJVAPYIEJN-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |