C17H13Cl2N3O4 — CID 6894450
2-(2,4-dichlorophenoxy)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide (PubChem CID 6894450) has the molecular formula C17H13Cl2N3O4 and a molecular weight of 394.21 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide |
|---|---|
| PubChem CID | 6894450 |
| Molecular Formula | C17H13Cl2N3O4 |
| Molecular Weight | 394.21 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-[(E)-[(E)-3-(3-nitrophenyl)prop-2-enylidene]amino]acetamide |
| SMILES | O=C(COc1ccc(Cl)cc1Cl)N/N=C/C=C/c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13Cl2N3O4/c18-13-6-7-16(15(19)10-13)26-11-17(23)21-20-8-2-4-12-3-1-5-14(9-12)22(24)25/h1-10H,11H2,(H,21,23)/b4-2+,20-8+ |
| InChIKey | BYEXUDQSCPNUQT-YAQJAHMSSA-N |
| XLogP | 4.10 |
| TPSA | 93.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.21 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|