C25H34N2O — CID 68945865
2-methyl-N-[3-[4-[(2-propan-2-ylindolizin-1-yl)methyl]phenoxy]propyl]propan-2-amine (PubChem CID 68945865) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-methyl-N-[3-[4-[(2-propan-2-ylindolizin-1-yl)methyl]phenoxy]propyl]propan-2-amine.
| Compound Name | 2-methyl-N-[3-[4-[(2-propan-2-ylindolizin-1-yl)methyl]phenoxy]propyl]propan-2-amine |
|---|---|
| PubChem CID | 68945865 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 2-methyl-N-[3-[4-[(2-propan-2-ylindolizin-1-yl)methyl]phenoxy]propyl]propan-2-amine |
| SMILES | CC(C)c1cn2ccccc2c1Cc1ccc(OCCCNC(C)(C)C)cc1 |
| InChI | InChI=1S/C25H34N2O/c1-19(2)23-18-27-15-7-6-9-24(27)22(23)17-20-10-12-21(13-11-20)28-16-8-14-26-25(3,4)5/h6-7,9-13,15,18-19,26H,8,14,16-17H2,1-5H3 |
| InChIKey | GQIJKXDDUYYCKO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 25.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|