C25H34N2O3S — CID 10049017
2-methyl-N-[3-[4-(1-methyl-2-propan-2-ylindol-3-yl)sulfonylphenoxy]propyl]propan-2-amine (PubChem CID 10049017) has the molecular formula C25H34N2O3S and a molecular weight of 442.63 g/mol. Its IUPAC name is 2-methyl-N-[3-[4-(1-methyl-2-propan-2-ylindol-3-yl)sulfonylphenoxy]propyl]propan-2-amine.
| Compound Name | 2-methyl-N-[3-[4-(1-methyl-2-propan-2-ylindol-3-yl)sulfonylphenoxy]propyl]propan-2-amine |
|---|---|
| PubChem CID | 10049017 |
| Molecular Formula | C25H34N2O3S |
| Molecular Weight | 442.63 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 2-methyl-N-[3-[4-(1-methyl-2-propan-2-ylindol-3-yl)sulfonylphenoxy]propyl]propan-2-amine |
| SMILES | CC(C)c1c(S(=O)(=O)c2ccc(OCCCNC(C)(C)C)cc2)c2ccccc2n1C |
| InChI | InChI=1S/C25H34N2O3S/c1-18(2)23-24(21-10-7-8-11-22(21)27(23)6)31(28,29)20-14-12-19(13-15-20)30-17-9-16-26-25(3,4)5/h7-8,10-15,18,26H,9,16-17H2,1-6H3 |
| InChIKey | BJZZZMYLHLRQKC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.63 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|