C20H22BrNO3S — CID 10478154
3-[4-(3-bromopropoxy)phenyl]sulfonyl-2-propan-2-yl-1H-indole (PubChem CID 10478154) has the molecular formula C20H22BrNO3S and a molecular weight of 436.37 g/mol. Its IUPAC name is 3-[4-(3-bromopropoxy)phenyl]sulfonyl-2-propan-2-yl-1H-indole.
| Compound Name | 3-[4-(3-bromopropoxy)phenyl]sulfonyl-2-propan-2-yl-1H-indole |
|---|---|
| PubChem CID | 10478154 |
| Molecular Formula | C20H22BrNO3S |
| Molecular Weight | 436.37 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | 3-[4-(3-bromopropoxy)phenyl]sulfonyl-2-propan-2-yl-1H-indole |
| SMILES | CC(C)c1[nH]c2ccccc2c1S(=O)(=O)c1ccc(OCCCBr)cc1 |
| InChI | InChI=1S/C20H22BrNO3S/c1-14(2)19-20(17-6-3-4-7-18(17)22-19)26(23,24)16-10-8-15(9-11-16)25-13-5-12-21/h3-4,6-11,14,22H,5,12-13H2,1-2H3 |
| InChIKey | UPKIWJMBVQAVQY-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|