C29H34N2O6S — CID 24896271
3,4,5-trimethoxy-N-[3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propyl]aniline (PubChem CID 24896271) has the molecular formula C29H34N2O6S and a molecular weight of 538.67 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propyl]aniline.
| Compound Name | 3,4,5-trimethoxy-N-[3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propyl]aniline |
|---|---|
| PubChem CID | 24896271 |
| Molecular Formula | C29H34N2O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | 3,4,5-trimethoxy-N-[3-[4-(2-propan-2-ylindolizin-1-yl)sulfonylphenoxy]propyl]aniline |
| SMILES | COc1cc(NCCCOc2ccc(S(=O)(=O)c3c(C(C)C)cn4ccccc34)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C29H34N2O6S/c1-20(2)24-19-31-15-7-6-9-25(31)29(24)38(32,33)23-12-10-22(11-13-23)37-16-8-14-30-21-17-26(34-3)28(36-5)27(18-21)35-4/h6-7,9-13,15,17-20,30H,8,14,16H2,1-5H3 |
| InChIKey | MRHIVEXJAJTFSO-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|