C27H27N7O — CID 68947786
5-[[(2R)-piperidin-2-yl]methoxy]-N-[1-(pyridin-2-ylmethyl)indazol-5-yl]quinazolin-4-amine (PubChem CID 68947786) has the molecular formula C27H27N7O and a molecular weight of 465.56 g/mol. Its IUPAC name is 5-[[(2R)-piperidin-2-yl]methoxy]-N-[1-(pyridin-2-ylmethyl)indazol-5-yl]quinazolin-4-amine.
| Compound Name | 5-[[(2R)-piperidin-2-yl]methoxy]-N-[1-(pyridin-2-ylmethyl)indazol-5-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 68947786 |
| Molecular Formula | C27H27N7O |
| Molecular Weight | 465.56 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 5-[[(2R)-piperidin-2-yl]methoxy]-N-[1-(pyridin-2-ylmethyl)indazol-5-yl]quinazolin-4-amine |
| SMILES | c1ccc(Cn2ncc3cc(Nc4ncnc5cccc(OC[C@H]6CCCCN6)c45)ccc32)nc1 |
| InChI | InChI=1S/C27H27N7O/c1-3-12-28-21(6-1)16-34-24-11-10-20(14-19(24)15-32-34)33-27-26-23(30-18-31-27)8-5-9-25(26)35-17-22-7-2-4-13-29-22/h1,3,5-6,8-12,14-15,18,22,29H,2,4,7,13,16-17H2,(H,30,31,33)/t22-/m1/s1 |
| InChIKey | UINKGFLZRJKYQW-JOCHJYFZSA-N |
| XLogP | 4.69 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |