C23H18N6O2 — CID 69296183
[4-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl] acetate (PubChem CID 69296183) has the molecular formula C23H18N6O2 and a molecular weight of 410.44 g/mol. Its IUPAC name is [4-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl] acetate.
| Compound Name | [4-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl] acetate |
|---|---|
| PubChem CID | 69296183 |
| Molecular Formula | C23H18N6O2 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [4-[[1-(pyridin-2-ylmethyl)indazol-5-yl]amino]quinazolin-5-yl] acetate |
| SMILES | CC(=O)Oc1cccc2ncnc(Nc3ccc4c(cnn4Cc4ccccn4)c3)c12 |
| InChI | InChI=1S/C23H18N6O2/c1-15(30)31-21-7-4-6-19-22(21)23(26-14-25-19)28-17-8-9-20-16(11-17)12-27-29(20)13-18-5-2-3-10-24-18/h2-12,14H,13H2,1H3,(H,25,26,28) |
| InChIKey | PRYCFWPCNQGBGS-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|