C20H16FN3O — CID 68965707
3-[1-[(3-cyanophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide (PubChem CID 68965707) has the molecular formula C20H16FN3O and a molecular weight of 333.37 g/mol. Its IUPAC name is 3-[1-[(3-cyanophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide.
| Compound Name | 3-[1-[(3-cyanophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide |
|---|---|
| PubChem CID | 68965707 |
| Molecular Formula | C20H16FN3O |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 3-[1-[(3-cyanophenyl)methyl]-5-fluoro-3-methylindol-7-yl]prop-2-enamide |
| SMILES | Cc1cn(Cc2cccc(C#N)c2)c2c(C=CC(N)=O)cc(F)cc12 |
| InChI | InChI=1S/C20H16FN3O/c1-13-11-24(12-15-4-2-3-14(7-15)10-22)20-16(5-6-19(23)25)8-17(21)9-18(13)20/h2-9,11H,12H2,1H3,(H2,23,25) |
| InChIKey | VOOQOGHVCJRWIQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|