C20H14Cl2FNO2 — CID 76617987
4-[1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]-2-oxobut-3-enal (PubChem CID 76617987) has the molecular formula C20H14Cl2FNO2 and a molecular weight of 390.24 g/mol. Its IUPAC name is 4-[1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]-2-oxobut-3-enal.
| Compound Name | 4-[1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]-2-oxobut-3-enal |
|---|---|
| PubChem CID | 76617987 |
| Molecular Formula | C20H14Cl2FNO2 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 4-[1-[(2,4-dichlorophenyl)methyl]-5-fluoro-3-methylindol-7-yl]-2-oxobut-3-enal |
| SMILES | Cc1cn(Cc2ccc(Cl)cc2Cl)c2c(C=CC(=O)C=O)cc(F)cc12 |
| InChI | InChI=1S/C20H14Cl2FNO2/c1-12-9-24(10-14-2-4-15(21)7-19(14)22)20-13(3-5-17(26)11-25)6-16(23)8-18(12)20/h2-9,11H,10H2,1H3 |
| InChIKey | DHDDNPCHCWKQSU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|