C27H20Cl2F2N2O4S — CID 71488335
(E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide (PubChem CID 71488335) has the molecular formula C27H20Cl2F2N2O4S and a molecular weight of 577.44 g/mol. Its IUPAC name is (E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 71488335 |
| Molecular Formula | C27H20Cl2F2N2O4S |
| Molecular Weight | 577.44 g/mol |
| Exact Mass | 576.05 |
| IUPAC Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4-fluorophenyl)sulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc2c3c(n(Cc4ccc(Cl)cc4Cl)c12)CCOC3)NS(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C27H20Cl2F2N2O4S/c28-18-3-1-17(24(29)12-18)14-33-25-9-10-37-15-23(25)22-13-20(31)11-16(27(22)33)2-8-26(34)32-38(35,36)21-6-4-19(30)5-7-21/h1-8,11-13H,9-10,14-15H2,(H,32,34)/b8-2+ |
| InChIKey | RSMCQSTYLZGJQS-KRXBUXKQSA-N |
| XLogP | 5.87 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.44 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|