C25H19Cl2FN2O4S2 — CID 71488378
(E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-thiophen-2-ylsulfonylprop-2-enamide (PubChem CID 71488378) has the molecular formula C25H19Cl2FN2O4S2 and a molecular weight of 565.48 g/mol. Its IUPAC name is (E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-thiophen-2-ylsulfonylprop-2-enamide.
| Compound Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-thiophen-2-ylsulfonylprop-2-enamide |
|---|---|
| PubChem CID | 71488378 |
| Molecular Formula | C25H19Cl2FN2O4S2 |
| Molecular Weight | 565.48 g/mol |
| Exact Mass | 564.01 |
| IUPAC Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-8-fluoro-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-thiophen-2-ylsulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cc(F)cc2c3c(n(Cc4ccc(Cl)cc4Cl)c12)CCOC3)NS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C25H19Cl2FN2O4S2/c26-17-5-3-16(21(27)11-17)13-30-22-7-8-34-14-20(22)19-12-18(28)10-15(25(19)30)4-6-23(31)29-36(32,33)24-2-1-9-35-24/h1-6,9-12H,7-8,13-14H2,(H,29,31)/b6-4+ |
| InChIKey | RYQHHUUAHZRSQW-GQCTYLIASA-N |
| XLogP | 5.79 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.48 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|