C25H18Cl4N2O4S2 — CID 172777898
(E)-3-[5-[(2,4-dichlorophenyl)methyl]-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylprop-2-enamide (PubChem CID 172777898) has the molecular formula C25H18Cl4N2O4S2 and a molecular weight of 616.38 g/mol. Its IUPAC name is (E)-3-[5-[(2,4-dichlorophenyl)methyl]-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylprop-2-enamide.
| Compound Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylprop-2-enamide |
|---|---|
| PubChem CID | 172777898 |
| Molecular Formula | C25H18Cl4N2O4S2 |
| Molecular Weight | 616.38 g/mol |
| Exact Mass | 613.95 |
| IUPAC Name | (E)-3-[5-[(2,4-dichlorophenyl)methyl]-3,4-dihydro-1H-pyrano[4,3-b]indol-6-yl]-N-(4,5-dichlorothiophen-2-yl)sulfonylprop-2-enamide |
| SMILES | O=C(/C=C/c1cccc2c3c(n(Cc4ccc(Cl)cc4Cl)c12)CCOC3)NS(=O)(=O)c1cc(Cl)c(Cl)s1 |
| InChI | InChI=1S/C25H18Cl4N2O4S2/c26-16-6-4-15(19(27)10-16)12-31-21-8-9-35-13-18(21)17-3-1-2-14(24(17)31)5-7-22(32)30-37(33,34)23-11-20(28)25(29)36-23/h1-7,10-11H,8-9,12-13H2,(H,30,32)/b7-5+ |
| InChIKey | NVVLNTOKNHJWIQ-FNORWQNLSA-N |
| XLogP | 6.96 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.38 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|