C32H38N6O4 — CID 68967423
N-(2-aminophenyl)-5-[[(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)carbamoyl-(4-pyrrolidin-1-ylbutyl)amino]methyl]pyridine-2-carboxamide (PubChem CID 68967423) has the molecular formula C32H38N6O4 and a molecular weight of 570.69 g/mol. Its IUPAC name is N-(2-aminophenyl)-5-[[(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)carbamoyl-(4-pyrrolidin-1-ylbutyl)amino]methyl]pyridine-2-carboxamide.
| Compound Name | N-(2-aminophenyl)-5-[[(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)carbamoyl-(4-pyrrolidin-1-ylbutyl)amino]methyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 68967423 |
| Molecular Formula | C32H38N6O4 |
| Molecular Weight | 570.69 g/mol |
| Exact Mass | 570.30 |
| IUPAC Name | N-(2-aminophenyl)-5-[[(6-cyclohexa-1,3-dien-1-yl-1,4-dioxin-2-yl)carbamoyl-(4-pyrrolidin-1-ylbutyl)amino]methyl]pyridine-2-carboxamide |
| SMILES | Nc1ccccc1NC(=O)c1ccc(CN(CCCCN2CCCC2)C(=O)NC2=COC=C(C3=CC=CCC3)O2)cn1 |
| InChI | InChI=1S/C32H38N6O4/c33-26-12-4-5-13-27(26)35-31(39)28-15-14-24(20-34-28)21-38(19-9-8-18-37-16-6-7-17-37)32(40)36-30-23-41-22-29(42-30)25-10-2-1-3-11-25/h1-2,4-5,10,12-15,20,22-23H,3,6-9,11,16-19,21,33H2,(H,35,39)(H,36,40) |
| InChIKey | MVXVCFYHXHJRJV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.69 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|