C14H24O5 — CID 68969679
2-(5-Methyl-2-propan-2-ylcyclohexyl)oxybutanedioic acid (PubChem CID 68969679) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(5-methyl-2-propan-2-ylcyclohexyl)oxybutanedioic acid.
| Compound Name | 2-(5-Methyl-2-propan-2-ylcyclohexyl)oxybutanedioic acid |
|---|---|
| PubChem CID | 68969679 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 2-(5-methyl-2-propan-2-ylcyclohexyl)oxybutanedioic acid |
| SMILES | CC1CCC(C(C1)OC(CC(=O)O)C(=O)O)C(C)C |
| InChI | InChI=1S/C14H24O5/c1-8(2)10-5-4-9(3)6-11(10)19-12(14(17)18)7-13(15)16/h8-12H,4-7H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | DXHJDCBPRXVQJS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | 326 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |