C26H29N3O4 — CID 68972475
1-[2-ethyl-5-oxido-1-(2-phenoxyethyl)imidazo[4,5-c]quinolin-5-ium-7-yl]oxy-3,3-dimethylbutan-2-one (PubChem CID 68972475) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 1-[2-ethyl-5-oxido-1-(2-phenoxyethyl)imidazo[4,5-c]quinolin-5-ium-7-yl]oxy-3,3-dimethylbutan-2-one.
| Compound Name | 1-[2-ethyl-5-oxido-1-(2-phenoxyethyl)imidazo[4,5-c]quinolin-5-ium-7-yl]oxy-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 68972475 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 1-[2-ethyl-5-oxido-1-(2-phenoxyethyl)imidazo[4,5-c]quinolin-5-ium-7-yl]oxy-3,3-dimethylbutan-2-one |
| SMILES | CCc1nc2c[n+]([O-])c3cc(OCC(=O)C(C)(C)C)ccc3c2n1CCOc1ccccc1 |
| InChI | InChI=1S/C26H29N3O4/c1-5-24-27-21-16-29(31)22-15-19(33-17-23(30)26(2,3)4)11-12-20(22)25(21)28(24)13-14-32-18-9-7-6-8-10-18/h6-12,15-16H,5,13-14,17H2,1-4H3 |
| InChIKey | DNKCSUZNVOVXJV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|