C14H15N5O2 — CID 68975625
2-pyridazin-3-yl-2-pyridin-2-ylpiperazine-1-carboxylic acid (PubChem CID 68975625) has the molecular formula C14H15N5O2 and a molecular weight of 285.31 g/mol. Its IUPAC name is 2-pyridazin-3-yl-2-pyridin-2-ylpiperazine-1-carboxylic acid.
| Compound Name | 2-pyridazin-3-yl-2-pyridin-2-ylpiperazine-1-carboxylic acid |
|---|---|
| PubChem CID | 68975625 |
| Molecular Formula | C14H15N5O2 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 2-pyridazin-3-yl-2-pyridin-2-ylpiperazine-1-carboxylic acid |
| SMILES | O=C(O)N1CCNCC1(c1ccccn1)c1cccnn1 |
| InChI | InChI=1S/C14H15N5O2/c20-13(21)19-9-8-15-10-14(19,11-4-1-2-6-16-11)12-5-3-7-17-18-12/h1-7,15H,8-10H2,(H,20,21) |
| InChIKey | GLRYSBSQIZVQJG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |