C25H41NO2 — CID 68982323
(8S,9S,10S,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-one (PubChem CID 68982323) has the molecular formula C25H41NO2 and a molecular weight of 387.61 g/mol. Its IUPAC name is (8S,9S,10S,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-one.
| Compound Name | (8S,9S,10S,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-one |
|---|---|
| PubChem CID | 68982323 |
| Molecular Formula | C25H41NO2 |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.31 |
| IUPAC Name | (8S,9S,10S,13S,14S)-3-[2-(diethylamino)ethoxy]-10,13-dimethyl-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-1-one |
| SMILES | CCN(CC)CCOC1=CC(=O)[C@@]2(C)C(CC[C@H]3[C@@H]4CCC[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C25H41NO2/c1-5-26(6-2)14-15-28-19-16-18-9-10-20-21-8-7-12-24(21,3)13-11-22(20)25(18,4)23(27)17-19/h17-18,20-22H,5-16H2,1-4H3/t18?,20-,21-,22-,24-,25-/m0/s1 |
| InChIKey | HEJDPABWKPTCLM-VEJBECQLSA-N |
| XLogP | 5.45 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |