C9H11F3O2 — CID 68982342
3-cyclobutyl-4,4,4-trifluoro-2-methylbut-2-enoic acid (PubChem CID 68982342) has the molecular formula C9H11F3O2 and a molecular weight of 208.18 g/mol. Its IUPAC name is 3-cyclobutyl-4,4,4-trifluoro-2-methylbut-2-enoic acid.
| Compound Name | 3-cyclobutyl-4,4,4-trifluoro-2-methylbut-2-enoic acid |
|---|---|
| PubChem CID | 68982342 |
| Molecular Formula | C9H11F3O2 |
| Molecular Weight | 208.18 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 3-cyclobutyl-4,4,4-trifluoro-2-methylbut-2-enoic acid |
| SMILES | CC(C(=O)O)=C(C1CCC1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3O2/c1-5(8(13)14)7(9(10,11)12)6-3-2-4-6/h6H,2-4H2,1H3,(H,13,14) |
| InChIKey | OJFCROYFHQSDTD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.18 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|