C23H35NO3 — CID 68990421
(3R)-3-[(1S)-5-methoxy-1-spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-ylpentyl]piperidine (PubChem CID 68990421) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is (3R)-3-[(1S)-5-methoxy-1-spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-ylpentyl]piperidine.
| Compound Name | (3R)-3-[(1S)-5-methoxy-1-spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-ylpentyl]piperidine |
|---|---|
| PubChem CID | 68990421 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | (3R)-3-[(1S)-5-methoxy-1-spiro[1,3-benzodioxole-2,1'-cyclohexane]-4-ylpentyl]piperidine |
| SMILES | COCCCC[C@H](c1cccc2c1OC1(CCCCC1)O2)[C@H]1CCCNC1 |
| InChI | InChI=1S/C23H35NO3/c1-25-16-6-3-10-19(18-9-8-15-24-17-18)20-11-7-12-21-22(20)27-23(26-21)13-4-2-5-14-23/h7,11-12,18-19,24H,2-6,8-10,13-17H2,1H3/t18-,19-/m0/s1 |
| InChIKey | ZWGYFGZVYCUWJF-OALUTQOASA-N |
| XLogP | 5.02 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|