C22H35NO2Si — CID 68850037
[7-[(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]pentyl]-1-benzofuran-2-yl]-trimethylsilane (PubChem CID 68850037) has the molecular formula C22H35NO2Si and a molecular weight of 373.61 g/mol. Its IUPAC name is [7-[(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]pentyl]-1-benzofuran-2-yl]-trimethylsilane.
| Compound Name | [7-[(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]pentyl]-1-benzofuran-2-yl]-trimethylsilane |
|---|---|
| PubChem CID | 68850037 |
| Molecular Formula | C22H35NO2Si |
| Molecular Weight | 373.61 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | [7-[(1S)-5-methoxy-1-[(3R)-piperidin-3-yl]pentyl]-1-benzofuran-2-yl]-trimethylsilane |
| SMILES | COCCCC[C@H](c1cccc2cc([Si](C)(C)C)oc12)[C@H]1CCCNC1 |
| InChI | InChI=1S/C22H35NO2Si/c1-24-14-6-5-11-19(18-10-8-13-23-16-18)20-12-7-9-17-15-21(25-22(17)20)26(2,3)4/h7,9,12,15,18-19,23H,5-6,8,10-11,13-14,16H2,1-4H3/t18-,19-/m0/s1 |
| InChIKey | PWQFEHYQNAWCQX-OALUTQOASA-N |
| XLogP | 4.88 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|