C15H27N3O5 — CID 68990515
[4-hydroxy-4-[(3R)-1-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]piperidin-3-yl]butyl]carbamic acid (PubChem CID 68990515) has the molecular formula C15H27N3O5 and a molecular weight of 329.40 g/mol. Its IUPAC name is [4-hydroxy-4-[(3R)-1-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]piperidin-3-yl]butyl]carbamic acid.
| Compound Name | [4-hydroxy-4-[(3R)-1-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]piperidin-3-yl]butyl]carbamic acid |
|---|---|
| PubChem CID | 68990515 |
| Molecular Formula | C15H27N3O5 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | [4-hydroxy-4-[(3R)-1-[(2S,4R)-4-hydroxypyrrolidine-2-carbonyl]piperidin-3-yl]butyl]carbamic acid |
| SMILES | O=C(O)NCCCC(O)[C@@H]1CCCN(C(=O)[C@@H]2C[C@@H](O)CN2)C1 |
| InChI | InChI=1S/C15H27N3O5/c19-11-7-12(17-8-11)14(21)18-6-2-3-10(9-18)13(20)4-1-5-16-15(22)23/h10-13,16-17,19-20H,1-9H2,(H,22,23)/t10-,11-,12+,13?/m1/s1 |
| InChIKey | SGXPJEGCEOWKQC-FKJOKYEKSA-N |
| XLogP | -0.64 |
| TPSA | 122.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|