C30H36FN3O6 — CID 68991878
3-fluoropropyl 4-[2-methoxy-4-[1-oxo-6-(oxolan-2-ylmethoxy)isoquinolin-2-yl]phenyl]-1,4-diazepane-1-carboxylate (PubChem CID 68991878) has the molecular formula C30H36FN3O6 and a molecular weight of 553.63 g/mol. Its IUPAC name is 3-fluoropropyl 4-[2-methoxy-4-[1-oxo-6-(oxolan-2-ylmethoxy)isoquinolin-2-yl]phenyl]-1,4-diazepane-1-carboxylate.
| Compound Name | 3-fluoropropyl 4-[2-methoxy-4-[1-oxo-6-(oxolan-2-ylmethoxy)isoquinolin-2-yl]phenyl]-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 68991878 |
| Molecular Formula | C30H36FN3O6 |
| Molecular Weight | 553.63 g/mol |
| Exact Mass | 553.26 |
| IUPAC Name | 3-fluoropropyl 4-[2-methoxy-4-[1-oxo-6-(oxolan-2-ylmethoxy)isoquinolin-2-yl]phenyl]-1,4-diazepane-1-carboxylate |
| SMILES | COc1cc(-n2ccc3cc(OCC4CCCO4)ccc3c2=O)ccc1N1CCCN(C(=O)OCCCF)CC1 |
| InChI | InChI=1S/C30H36FN3O6/c1-37-28-20-23(6-9-27(28)32-12-4-13-33(16-15-32)30(36)39-18-3-11-31)34-14-10-22-19-24(7-8-26(22)29(34)35)40-21-25-5-2-17-38-25/h6-10,14,19-20,25H,2-5,11-13,15-18,21H2,1H3 |
| InChIKey | XAWQMMOZECCPHX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 82.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|