C28H32FN3O4 — CID 76640844
2-[3-fluoro-4-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one (PubChem CID 76640844) has the molecular formula C28H32FN3O4 and a molecular weight of 493.58 g/mol. Its IUPAC name is 2-[3-fluoro-4-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one.
| Compound Name | 2-[3-fluoro-4-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one |
|---|---|
| PubChem CID | 76640844 |
| Molecular Formula | C28H32FN3O4 |
| Molecular Weight | 493.58 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | 2-[3-fluoro-4-(1-oxa-4,9-diazaspiro[5.5]undecan-9-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one |
| SMILES | O=c1c2ccc(OCC3CCCO3)cc2ccn1-c1ccc(N2CCC3(CC2)CNCCO3)c(F)c1 |
| InChI | InChI=1S/C28H32FN3O4/c29-25-17-21(3-6-26(25)31-12-8-28(9-13-31)19-30-10-15-36-28)32-11-7-20-16-22(4-5-24(20)27(32)33)35-18-23-2-1-14-34-23/h3-7,11,16-17,23,30H,1-2,8-10,12-15,18-19H2 |
| InChIKey | SRTTYBRGSQQYCE-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|