C24H23FN2O4 — CID 68992024
2-[3-fluoro-4-(3-oxopyrrolidin-1-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one (PubChem CID 68992024) has the molecular formula C24H23FN2O4 and a molecular weight of 422.46 g/mol. Its IUPAC name is 2-[3-fluoro-4-(3-oxopyrrolidin-1-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one.
| Compound Name | 2-[3-fluoro-4-(3-oxopyrrolidin-1-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one |
|---|---|
| PubChem CID | 68992024 |
| Molecular Formula | C24H23FN2O4 |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.16 |
| IUPAC Name | 2-[3-fluoro-4-(3-oxopyrrolidin-1-yl)phenyl]-6-(oxolan-2-ylmethoxy)isoquinolin-1-one |
| SMILES | O=C1CCN(c2ccc(-n3ccc4cc(OCC5CCCO5)ccc4c3=O)cc2F)C1 |
| InChI | InChI=1S/C24H23FN2O4/c25-22-13-17(3-6-23(22)26-9-8-18(28)14-26)27-10-7-16-12-19(4-5-21(16)24(27)29)31-15-20-2-1-11-30-20/h3-7,10,12-13,20H,1-2,8-9,11,14-15H2 |
| InChIKey | BYBASTUPZCPJJU-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|