C27H32FN3O3 — CID 89335372
2-[[1-[2-fluoro-4-[1-methylidene-6-[[(2R)-oxolan-2-yl]methoxy]isoquinolin-2-yl]phenyl]pyrrolidin-3-yl]amino]ethanol (PubChem CID 89335372) has the molecular formula C27H32FN3O3 and a molecular weight of 465.57 g/mol. Its IUPAC name is 2-[[1-[2-fluoro-4-[1-methylidene-6-[[(2R)-oxolan-2-yl]methoxy]isoquinolin-2-yl]phenyl]pyrrolidin-3-yl]amino]ethanol.
| Compound Name | 2-[[1-[2-fluoro-4-[1-methylidene-6-[[(2R)-oxolan-2-yl]methoxy]isoquinolin-2-yl]phenyl]pyrrolidin-3-yl]amino]ethanol |
|---|---|
| PubChem CID | 89335372 |
| Molecular Formula | C27H32FN3O3 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[[1-[2-fluoro-4-[1-methylidene-6-[[(2R)-oxolan-2-yl]methoxy]isoquinolin-2-yl]phenyl]pyrrolidin-3-yl]amino]ethanol |
| SMILES | C=C1c2ccc(OC[C@H]3CCCO3)cc2C=CN1c1ccc(N2CCC(NCCO)C2)c(F)c1 |
| InChI | InChI=1S/C27H32FN3O3/c1-19-25-6-5-23(34-18-24-3-2-14-33-24)15-20(25)8-12-31(19)22-4-7-27(26(28)16-22)30-11-9-21(17-30)29-10-13-32/h4-8,12,15-16,21,24,29,32H,1-3,9-11,13-14,17-18H2/t21?,24-/m1/s1 |
| InChIKey | FDINMVMFFKRULW-MQNHUJCZSA-N |
| XLogP | 4.01 |
| TPSA | 57.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|