C15H22NO7P — CID 69000483
(2-ethoxycarbonylphenoxy)-N-(1-ethoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid (PubChem CID 69000483) has the molecular formula C15H22NO7P and a molecular weight of 359.32 g/mol. Its IUPAC name is (2-ethoxycarbonylphenoxy)-N-(1-ethoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid.
| Compound Name | (2-ethoxycarbonylphenoxy)-N-(1-ethoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid |
|---|---|
| PubChem CID | 69000483 |
| Molecular Formula | C15H22NO7P |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (2-ethoxycarbonylphenoxy)-N-(1-ethoxy-2-methyl-1-oxopropan-2-yl)phosphonamidic acid |
| SMILES | CCOC(=O)c1ccccc1OP(=O)(O)NC(C)(C)C(=O)OCC |
| InChI | InChI=1S/C15H22NO7P/c1-5-21-13(17)11-9-7-8-10-12(11)23-24(19,20)16-15(3,4)14(18)22-6-2/h7-10H,5-6H2,1-4H3,(H2,16,19,20) |
| InChIKey | DITZDPNFSNVVNH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|