C22H23NO2S — CID 69005170
5-(4-methylphenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid (PubChem CID 69005170) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is 5-(4-methylphenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid.
| Compound Name | 5-(4-methylphenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid |
|---|---|
| PubChem CID | 69005170 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-(4-methylphenyl)-4-phenyl-2-(1,3-thiazol-2-yl)hexanoic acid |
| SMILES | Cc1ccc(C(C)C(CC(C(=O)O)c2nccs2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H23NO2S/c1-15-8-10-17(11-9-15)16(2)19(18-6-4-3-5-7-18)14-20(22(24)25)21-23-12-13-26-21/h3-13,16,19-20H,14H2,1-2H3,(H,24,25) |
| InChIKey | KIYZRQUYDZCORX-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |