About 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid
4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid (PubChem CID 69003827) has the molecular formula C21H21NO2S
and a molecular weight of 351.47 g/mol. Its IUPAC name is 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid.
Molecular Properties
| Compound Name | 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid |
| PubChem CID | 69003827 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid |
| SMILES | CC(c1ccccc1)C(CC(C(=O)O)c1nccs1)c1ccccc1 |
| InChI | InChI=1S/C21H21NO2S/c1-15(16-8-4-2-5-9-16)18(17-10-6-3-7-11-17)14-19(21(23)24)20-22-12-13-25-20/h2-13,15,18-19H,14H2,1H3,(H,23,24) |
| InChIKey | JRPNPQGOXKAQPJ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
The IUPAC name of 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid (CID 69003827) is 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid.
What is the SMILES notation for 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
The canonical SMILES for 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid is CC(c1ccccc1)C(CC(C(=O)O)c1nccs1)c1ccccc1.
What is the InChIKey of 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
The InChIKey is JRPNPQGOXKAQPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2S/c1-15(16-8-4-2-5-9-16)18(17-10-6-3-7-11-17)14-19(21(23)24)20-22-12-13-25-20/h2-13,15,18-19H,14H2,1H3,(H,23,24).
What are the key properties of 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid?
4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid has a molecular weight of 351.47 g/mol, XLogP of 5.29, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-diphenyl-2-(1,3-thiazol-2-yl)hexanoic acid is sourced from PubChem (CID 69003827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).