C25H23F4N3O2 — CID 69008295
2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,6-dimethyl-4-[(1S)-1-(2,3,4-trifluorophenyl)ethyl]morpholin-3-one (PubChem CID 69008295) has the molecular formula C25H23F4N3O2 and a molecular weight of 473.47 g/mol. Its IUPAC name is 2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,6-dimethyl-4-[(1S)-1-(2,3,4-trifluorophenyl)ethyl]morpholin-3-one.
| Compound Name | 2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,6-dimethyl-4-[(1S)-1-(2,3,4-trifluorophenyl)ethyl]morpholin-3-one |
|---|---|
| PubChem CID | 69008295 |
| Molecular Formula | C25H23F4N3O2 |
| Molecular Weight | 473.47 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | 2-[[3-fluoro-4-(4-methylimidazol-1-yl)phenyl]methylidene]-6,6-dimethyl-4-[(1S)-1-(2,3,4-trifluorophenyl)ethyl]morpholin-3-one |
| SMILES | Cc1cn(-c2ccc(C=C3OC(C)(C)CN([C@@H](C)c4ccc(F)c(F)c4F)C3=O)cc2F)cn1 |
| InChI | InChI=1S/C25H23F4N3O2/c1-14-11-31(13-30-14)20-8-5-16(9-19(20)27)10-21-24(33)32(12-25(3,4)34-21)15(2)17-6-7-18(26)23(29)22(17)28/h5-11,13,15H,12H2,1-4H3/t15-/m0/s1 |
| InChIKey | YCSWASAPAFCYPT-HNNXBMFYSA-N |
| XLogP | 5.48 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|