C22H18N4O2S — CID 69009342
(3S)-3-[[7-cyano-2-(2-phenylethynyl)thieno[3,2-c]pyridin-4-yl]amino]piperidine-1-carboxylic acid (PubChem CID 69009342) has the molecular formula C22H18N4O2S and a molecular weight of 402.48 g/mol. Its IUPAC name is (3S)-3-[[7-cyano-2-(2-phenylethynyl)thieno[3,2-c]pyridin-4-yl]amino]piperidine-1-carboxylic acid.
| Compound Name | (3S)-3-[[7-cyano-2-(2-phenylethynyl)thieno[3,2-c]pyridin-4-yl]amino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 69009342 |
| Molecular Formula | C22H18N4O2S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (3S)-3-[[7-cyano-2-(2-phenylethynyl)thieno[3,2-c]pyridin-4-yl]amino]piperidine-1-carboxylic acid |
| SMILES | N#Cc1cnc(N[C@H]2CCCN(C(=O)O)C2)c2cc(C#Cc3ccccc3)sc12 |
| InChI | InChI=1S/C22H18N4O2S/c23-12-16-13-24-21(25-17-7-4-10-26(14-17)22(27)28)19-11-18(29-20(16)19)9-8-15-5-2-1-3-6-15/h1-3,5-6,11,13,17H,4,7,10,14H2,(H,24,25)(H,27,28)/t17-/m0/s1 |
| InChIKey | BWTHTIVQBAJWOI-KRWDZBQOSA-N |
| XLogP | 4.12 |
| TPSA | 89.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|