C26H42O6 — CID 69009572
2-(1-ethenoxyethoxy)ethyl 4-methyl-2-methylidenepentanoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate (PubChem CID 69009572) has the molecular formula C26H42O6 and a molecular weight of 450.62 g/mol. Its IUPAC name is 2-(1-ethenoxyethoxy)ethyl 4-methyl-2-methylidenepentanoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate.
| Compound Name | 2-(1-ethenoxyethoxy)ethyl 4-methyl-2-methylidenepentanoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
|---|---|
| PubChem CID | 69009572 |
| Molecular Formula | C26H42O6 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.30 |
| IUPAC Name | 2-(1-ethenoxyethoxy)ethyl 4-methyl-2-methylidenepentanoate;[(1S,2S,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] prop-2-enoate |
| SMILES | C=CC(=O)O[C@H]1C[C@@H]2CC[C@@]1(C)C2(C)C.C=COC(C)OCCOC(=O)C(=C)CC(C)C |
| InChI | InChI=1S/C13H22O4.C13H20O2/c1-6-15-12(5)16-7-8-17-13(14)11(4)9-10(2)3;1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h6,10,12H,1,4,7-9H2,2-3,5H3;5,9-10H,1,6-8H2,2-4H3/t;9-,10-,13+/m.0/s1 |
| InChIKey | HCYSXUKHAHTKHF-NYFXSFQQSA-N |
| XLogP | 5.59 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|