About 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid
2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid (PubChem CID 69011131) has the molecular formula C24H21Br2NO5
and a molecular weight of 563.24 g/mol. Its IUPAC name is 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid.
Molecular Properties
| Compound Name | 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid |
| PubChem CID | 69011131 |
| Molecular Formula | C24H21Br2NO5 |
| Molecular Weight | 563.24 g/mol |
| Exact Mass | 560.98 |
| IUPAC Name | 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid |
| SMILES | Cc1cc(Oc2c(Br)cc(CC(=O)N(CC(=O)O)c3ccccc3)cc2Br)cc(C)c1O |
| InChI | InChI=1S/C24H21Br2NO5/c1-14-8-18(9-15(2)23(14)31)32-24-19(25)10-16(11-20(24)26)12-21(28)27(13-22(29)30)17-6-4-3-5-7-17/h3-11,31H,12-13H2,1-2H3,(H,29,30) |
| InChIKey | JFTUSVNGHQHEPG-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 563.24 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid?
The IUPAC name of 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid (CID 69011131) is 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid.
What is the SMILES notation for 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid?
The canonical SMILES for 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid is Cc1cc(Oc2c(Br)cc(CC(=O)N(CC(=O)O)c3ccccc3)cc2Br)cc(C)c1O.
What is the InChIKey of 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid?
The InChIKey is JFTUSVNGHQHEPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21Br2NO5/c1-14-8-18(9-15(2)23(14)31)32-24-19(25)10-16(11-20(24)26)12-21(28)27(13-22(29)30)17-6-4-3-5-7-17/h3-11,31H,12-13H2,1-2H3,(H,29,30).
What are the key properties of 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid?
2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid has a molecular weight of 563.24 g/mol, XLogP of 5.99, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(N-[2-[3,5-dibromo-4-(4-hydroxy-3,5-dimethylphenoxy)phenyl]acetyl]anilino)acetic acid is sourced from PubChem (CID 69011131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).