About 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one
1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one (PubChem CID 69011276) has the molecular formula C25H22O3
and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one.
Molecular Properties
| Compound Name | 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one |
| PubChem CID | 69011276 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one |
| SMILES | C/C=C/c1ccc(OC)cc1.O=c1c(-c2ccccc2)coc2ccccc12 |
| InChI | InChI=1S/C15H10O2.C10H12O/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11;1-3-4-9-5-7-10(11-2)8-6-9/h1-10H;3-8H,1-2H3/b;4-3+ |
| InChIKey | JOSVCWSMLGHEKG-SCBDLNNBSA-N |
| XLogP | 6.19 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one?
The IUPAC name of 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one (CID 69011276) is 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one.
What is the SMILES notation for 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one?
The canonical SMILES for 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one is C/C=C/c1ccc(OC)cc1.O=c1c(-c2ccccc2)coc2ccccc12.
What is the InChIKey of 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one?
The InChIKey is JOSVCWSMLGHEKG-SCBDLNNBSA-N. The full InChI is InChI=1S/C15H10O2.C10H12O/c16-15-12-8-4-5-9-14(12)17-10-13(15)11-6-2-1-3-7-11;1-3-4-9-5-7-10(11-2)8-6-9/h1-10H;3-8H,1-2H3/b;4-3+.
What are the key properties of 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one?
1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one has a molecular weight of 370.45 g/mol, XLogP of 6.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-4-[(E)-prop-1-enyl]benzene;3-phenylchromen-4-one is sourced from PubChem (CID 69011276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).