C23H22N4O2 — CID 69014896
1,9-dibenzyl-8-(2-ethoxyethenyl)purin-6-one (PubChem CID 69014896) has the molecular formula C23H22N4O2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1,9-dibenzyl-8-(2-ethoxyethenyl)purin-6-one.
| Compound Name | 1,9-dibenzyl-8-(2-ethoxyethenyl)purin-6-one |
|---|---|
| PubChem CID | 69014896 |
| Molecular Formula | C23H22N4O2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.17 |
| IUPAC Name | 1,9-dibenzyl-8-(2-ethoxyethenyl)purin-6-one |
| SMILES | CCOC=Cc1nc2c(=O)n(Cc3ccccc3)cnc2n1Cc1ccccc1 |
| InChI | InChI=1S/C23H22N4O2/c1-2-29-14-13-20-25-21-22(27(20)16-19-11-7-4-8-12-19)24-17-26(23(21)28)15-18-9-5-3-6-10-18/h3-14,17H,2,15-16H2,1H3 |
| InChIKey | AKRAPPMMVBFIFV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|