C15H16ClN3O4 — CID 69015701
(2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;3-chloropyrrolidine-2,5-dione (PubChem CID 69015701) has the molecular formula C15H16ClN3O4 and a molecular weight of 337.76 g/mol. Its IUPAC name is (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;3-chloropyrrolidine-2,5-dione.
| Compound Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;3-chloropyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 69015701 |
| Molecular Formula | C15H16ClN3O4 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | (2S)-2-amino-3-(1H-indol-3-yl)propanoic acid;3-chloropyrrolidine-2,5-dione |
| SMILES | N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O.O=C1CC(Cl)C(=O)N1 |
| InChI | InChI=1S/C11H12N2O2.C4H4ClNO2/c12-9(11(14)15)5-7-6-13-10-4-2-1-3-8(7)10;5-2-1-3(7)6-4(2)8/h1-4,6,9,13H,5,12H2,(H,14,15);2H,1H2,(H,6,7,8)/t9-;/m0./s1 |
| InChIKey | QJOGRPSZMXDSNP-FVGYRXGTSA-N |
| XLogP | 0.76 |
| TPSA | 125.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|