C21H17ClN2O3S — CID 69016760
2-chloro-N-[6-[(2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-yl)oxy]-3-pyridinyl]acetamide (PubChem CID 69016760) has the molecular formula C21H17ClN2O3S and a molecular weight of 412.90 g/mol. Its IUPAC name is 2-chloro-N-[6-[(2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-yl)oxy]-3-pyridinyl]acetamide.
| Compound Name | 2-chloro-N-[6-[(2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-yl)oxy]-3-pyridinyl]acetamide |
|---|---|
| PubChem CID | 69016760 |
| Molecular Formula | C21H17ClN2O3S |
| Molecular Weight | 412.90 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 2-chloro-N-[6-[(2-phenyl-2,3-dihydro-1,4-benzoxathiin-6-yl)oxy]-3-pyridinyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(Oc2ccc3c(c2)SCC(c2ccccc2)O3)nc1 |
| InChI | InChI=1S/C21H17ClN2O3S/c22-11-20(25)24-15-6-9-21(23-12-15)26-16-7-8-17-19(10-16)28-13-18(27-17)14-4-2-1-3-5-14/h1-10,12,18H,11,13H2,(H,24,25) |
| InChIKey | AADZAMMSGUWFEA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|