C22H24F3N3O3 — CID 69017476
tert-butyl (2S)-2-[4,5,6-trifluoro-3-(2-methylphenyl)pyridine-2-carbonyl]piperazine-1-carboxylate (PubChem CID 69017476) has the molecular formula C22H24F3N3O3 and a molecular weight of 435.45 g/mol. Its IUPAC name is tert-butyl (2S)-2-[4,5,6-trifluoro-3-(2-methylphenyl)pyridine-2-carbonyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[4,5,6-trifluoro-3-(2-methylphenyl)pyridine-2-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 69017476 |
| Molecular Formula | C22H24F3N3O3 |
| Molecular Weight | 435.45 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | tert-butyl (2S)-2-[4,5,6-trifluoro-3-(2-methylphenyl)pyridine-2-carbonyl]piperazine-1-carboxylate |
| SMILES | Cc1ccccc1-c1c(C(=O)[C@@H]2CNCCN2C(=O)OC(C)(C)C)nc(F)c(F)c1F |
| InChI | InChI=1S/C22H24F3N3O3/c1-12-7-5-6-8-13(12)15-16(23)17(24)20(25)27-18(15)19(29)14-11-26-9-10-28(14)21(30)31-22(2,3)4/h5-8,14,26H,9-11H2,1-4H3/t14-/m0/s1 |
| InChIKey | LIKIPTBMUQIEAO-AWEZNQCLSA-N |
| XLogP | 3.87 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|