C24H39ClN4 — CID 69019434
1-(7-chloroquinolin-4-yl)-1-N,1-N,7-N,7-N-tetraethylheptane-1,4,7-triamine (PubChem CID 69019434) has the molecular formula C24H39ClN4 and a molecular weight of 419.06 g/mol. Its IUPAC name is 1-(7-chloroquinolin-4-yl)-1-N,1-N,7-N,7-N-tetraethylheptane-1,4,7-triamine.
| Compound Name | 1-(7-chloroquinolin-4-yl)-1-N,1-N,7-N,7-N-tetraethylheptane-1,4,7-triamine |
|---|---|
| PubChem CID | 69019434 |
| Molecular Formula | C24H39ClN4 |
| Molecular Weight | 419.06 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | 1-(7-chloroquinolin-4-yl)-1-N,1-N,7-N,7-N-tetraethylheptane-1,4,7-triamine |
| SMILES | CCN(CC)CCCC(N)CCC(c1ccnc2cc(Cl)ccc12)N(CC)CC |
| InChI | InChI=1S/C24H39ClN4/c1-5-28(6-2)17-9-10-20(26)12-14-24(29(7-3)8-4)22-15-16-27-23-18-19(25)11-13-21(22)23/h11,13,15-16,18,20,24H,5-10,12,14,17,26H2,1-4H3 |
| InChIKey | LSFXHKWOKIHCEZ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.06 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |