C9H10F2O3 — CID 69021676
[difluoro(7-oxabicyclo[2.2.1]hept-5-en-2-yl)methyl] acetate (PubChem CID 69021676) has the molecular formula C9H10F2O3 and a molecular weight of 204.17 g/mol. Its IUPAC name is [difluoro(7-oxabicyclo[2.2.1]hept-5-en-2-yl)methyl] acetate.
| Compound Name | [difluoro(7-oxabicyclo[2.2.1]hept-5-en-2-yl)methyl] acetate |
|---|---|
| PubChem CID | 69021676 |
| Molecular Formula | C9H10F2O3 |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | [difluoro(7-oxabicyclo[2.2.1]hept-5-en-2-yl)methyl] acetate |
| SMILES | CC(=O)OC(F)(F)C1CC2C=CC1O2 |
| InChI | InChI=1S/C9H10F2O3/c1-5(12)14-9(10,11)7-4-6-2-3-8(7)13-6/h2-3,6-8H,4H2,1H3 |
| InChIKey | ZNVJZNGOKQBLCD-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|