C18H17ClF3N3O5S — CID 69023434
4-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]-6-chloro-1H-pyridin-2-one (PubChem CID 69023434) has the molecular formula C18H17ClF3N3O5S and a molecular weight of 479.86 g/mol. Its IUPAC name is 4-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]-6-chloro-1H-pyridin-2-one.
| Compound Name | 4-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]-6-chloro-1H-pyridin-2-one |
|---|---|
| PubChem CID | 69023434 |
| Molecular Formula | C18H17ClF3N3O5S |
| Molecular Weight | 479.86 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 4-[aminooxy-[1-[4-(trifluoromethoxy)phenyl]sulfonylpiperidin-4-ylidene]methyl]-6-chloro-1H-pyridin-2-one |
| SMILES | NOC(=C1CCN(S(=O)(=O)c2ccc(OC(F)(F)F)cc2)CC1)c1cc(Cl)[nH]c(=O)c1 |
| InChI | InChI=1S/C18H17ClF3N3O5S/c19-15-9-12(10-16(26)24-15)17(30-23)11-5-7-25(8-6-11)31(27,28)14-3-1-13(2-4-14)29-18(20,21)22/h1-4,9-10H,5-8,23H2,(H,24,26) |
| InChIKey | XNMKRYJOGNCYCG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 114.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.86 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|