C38H66F2OSi2 — CID 69029811
4-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenoxy]butyl-[3-[dimethyl(3-methylpentyl)silyl]propyl]-dimethylsilane (PubChem CID 69029811) has the molecular formula C38H66F2OSi2 and a molecular weight of 633.11 g/mol. Its IUPAC name is 4-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenoxy]butyl-[3-[dimethyl(3-methylpentyl)silyl]propyl]-dimethylsilane.
| Compound Name | 4-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenoxy]butyl-[3-[dimethyl(3-methylpentyl)silyl]propyl]-dimethylsilane |
|---|---|
| PubChem CID | 69029811 |
| Molecular Formula | C38H66F2OSi2 |
| Molecular Weight | 633.11 g/mol |
| Exact Mass | 632.46 |
| IUPAC Name | 4-[2,3-difluoro-4-[4-(4-propylcyclohexyl)cyclohexen-1-yl]phenoxy]butyl-[3-[dimethyl(3-methylpentyl)silyl]propyl]-dimethylsilane |
| SMILES | CCCC1CCC(C2CC=C(c3ccc(OCCCC[Si](C)(C)CCC[Si](C)(C)CCC(C)CC)c(F)c3F)CC2)CC1 |
| InChI | InChI=1S/C38H66F2OSi2/c1-8-13-31-14-16-32(17-15-31)33-18-20-34(21-19-33)35-22-23-36(38(40)37(35)39)41-25-10-11-26-42(4,5)27-12-28-43(6,7)29-24-30(3)9-2/h20,22-23,30-33H,8-19,21,24-29H2,1-7H3 |
| InChIKey | YNJHVMPLMMULNL-UHFFFAOYSA-N |
| XLogP | 13.16 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.11 |
| LogP ≤ 5 | 13.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|