C19H20N2O6 — CID 69031457
carbamic acid;3-methyl-2-(3-phenylprop-2-enoxycarbonylamino)benzoic acid (PubChem CID 69031457) has the molecular formula C19H20N2O6 and a molecular weight of 372.38 g/mol. Its IUPAC name is carbamic acid;3-methyl-2-(3-phenylprop-2-enoxycarbonylamino)benzoic acid.
| Compound Name | carbamic acid;3-methyl-2-(3-phenylprop-2-enoxycarbonylamino)benzoic acid |
|---|---|
| PubChem CID | 69031457 |
| Molecular Formula | C19H20N2O6 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | carbamic acid;3-methyl-2-(3-phenylprop-2-enoxycarbonylamino)benzoic acid |
| SMILES | Cc1cccc(C(=O)O)c1NC(=O)OCC=Cc1ccccc1.NC(=O)O |
| InChI | InChI=1S/C18H17NO4.CH3NO2/c1-13-7-5-11-15(17(20)21)16(13)19-18(22)23-12-6-10-14-8-3-2-4-9-14;2-1(3)4/h2-11H,12H2,1H3,(H,19,22)(H,20,21);2H2,(H,3,4) |
| InChIKey | PHHWXEAFIHTBLH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 138.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |